Nanjing Herrman Chemicals Factory

Showing 1 - 10 of 16, total 2 pages [First] [Previous] [Next] [Last]

- chloropropyl methyl diethoxysilane ah-708
Specification: AH-708
Detail: 1. Chemical Name: -Chloropropyl Methyl Diethoxysilane 2. Molecular Formula: Cl(CH2)3SiCH3(OC2H5)2 3. Properties: Colorless tran***rent liquid, soluble in a variety of organic solvents. CAS No.: N.A...

- chloropropyl methyl dimethoxysilane ah-707
Specification: AH-707
Detail: 1. Chemical Name: -Chloropropyl Methyl Dimethoxysilane 2. Molecular Formula: Cl(CH2)3SiCH3(OCH3)2 3. Properties: Colorless tran***rent liquid, soluble in a variety of organic solvents. CAS No.: 1817...

h-trimethoxysilane ah-705
Specification: AH-705 Trimethoxysilane
Detail: ¡ô TYPICAL PHYSICAL PROPERTIES: Appearance clear light staraw liquid Molecular Weight 121 Specific Gravity at 25/25¡æ 1.3681--1.3687 Refractive index Nd 25¡æ 0.86 Flash Point, Tag closed Cup,...

n-( 2-aminoethyl)-aminopropylmethyldimethoxysilane ah-602(kbm602
Specification: AH-602(KBM-602 A-2120)
Detail: 1. Chemical Name: N-( 2-aminoethyl)- -aminopropylmethyldimethoxysilane 2. Formula: NH2(CH2)2NH(CH2)3SiCH3(OCH3)2 3. Property and Index: Colorless tran***rent liquid. CAS No.: 1760-24-3 Molecular Weight...

bis-[ -(triethoxysilyl)-propyl]-tetrasulfide ah-si69(si69)
Specification: AH-Si69(A-1289 Si-69)
Detail: 1. Chemical Name:Si-69 Bis-[ -(triethoxysilyl)-propyl]-tetrasulfide 2. Molecular Formula: 3.Physical Properties Light yellow tran***rent liquid with slight ethyl alcohol odor, easily soluble in ...

ferrous sulphate heptahydrate(light green crystal
Specification: Ferrous Sulphate Heptahydrate(Light green crystal
Detail: ¡ô Property:Blue tran***rent crystal or powder,airslake in dry air,soluble in water,slightly in methanol,insoluble in anhydrous ethanol. ¡ô Use: It is mainly used to make pigment such as Ferric Oxide series product...

y-chloropropyltrimethoxysilane ah-703(kbm-703)
Specification: AH-703(KBM-703 A-143)
Detail: 1. Chemical Name: Y-Chloropropyltrimethoxysilane 2. Molecular Formula: C1CH2CH2CH2Si(OCH3)3 3. Properties: Colorless tran***rent liquid, soluble in a variety of organic solvents, hydrolyz...

y-chloropropyl triethoxysilane ah-704(l6376)
Specification: AH-704(L-6376)
Detail: 1. Chemical Name: Y-Chloropropyl Triethoxysilane 2. Molecular Formula: Cl(CH2)3Si(OC2H5)3 3. Properties: Colorless tran***rent liquid, soluble in organic solvent such as alcohol, ketone and ben...

vingyltriethoxy silane ah-151(a-151)
Specification: AH-151(A-151)
Detail: 1. Chemical Name:AH-151 Vingyltriethoxysilane 2. Molecular Formula: CH2=CHSi(OC2H5)3 3. Property and Index: Colorless or yellowish tran***rent liquid, soluble in organic solvent, insoluble in th...

vinyltrimethoxy silane ah-171(a-171.vimo)
Specification: AH-171(A-171 VIMO)
Detail: 1. Chemical Name:171 Vinyltrimethoxysilane 2. Molecular Formula: CH2=CHSi(OCH3)3 3. Property and Index:Colorless or yellowish tran***rent liquid, soluble in organic solvents such as alcohol, toluene, propanone, be...


Showing 1 - 10 of 16, total 2 pages [First] [Previous] [Next] [Last]
1 2